Introduction：Basic information about CAS 1083100-27-9|N-[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl Lansoprazole Sulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl Lansoprazole Sulfide |
|---|
| CAS Number | 1083100-27-9 | Molecular Weight | 556.523 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 622.9±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22F6N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 330.5±34.3 °C |
|---|
Names
| Name | N-[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl Lansoprazole Sulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 622.9±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22F6N4O2S |
|---|
| Molecular Weight | 556.523 |
|---|
| Flash Point | 330.5±34.3 °C |
|---|
| Exact Mass | 556.136780 |
|---|
| PSA | 87.36000 |
|---|
| LogP | 6.69 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | YUCQMNLWRFIFNG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CSc1nc2ccccc2n1Cc1nccc(OCC(F)(F)F)c1C |
|---|
Synonyms
| 1H-Benzimidazole, 1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]- |
| 1-{[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl}-2-({[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl}sulfanyl)-1H-benzimidazole |
| 1-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methyl]-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfanyl]benzimidazole |
| Lansoprazole Impurity 7 |
