Introduction：Basic information about CAS 4684-28-0|3-Oxa-9-azatricyclo[3.3.1.02,4]non-7-yl tropate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Oxa-9-azatricyclo[3.3.1.02,4]non-7-yl tropate |
|---|
| CAS Number | 4684-28-0 | Molecular Weight | 289.326 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 474.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.9±28.7 °C |
|---|
Names
| Name | 3-Oxa-9-azatricyclo[3.3.1.02,4]non-7-yl tropate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 474.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19NO4 |
|---|
| Molecular Weight | 289.326 |
|---|
| Flash Point | 240.9±28.7 °C |
|---|
| Exact Mass | 289.131409 |
|---|
| PSA | 71.09000 |
|---|
| LogP | 0.71 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | MOYZEMOPQDTDHA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OC1CC2NC(C1)C1OC21)C(CO)c1ccccc1 |
|---|
Safety Information
Synonyms
| Benzeneacetic acid, α-(hydroxymethyl)-, 3-oxa-9-azatricyclo[3.3.1.0]non-7-yl ester |
| Nor Scopolamine |
| Adiposettin |
| Reduform |
| Minusin |
| Norscopolamin |
| Hyoscine impurity A |
| 3-Oxa-9-azatricyclo[3.3.1.0]non-7-yl tropate |
| Hyoscine hydrobromide impurity B |
| Amorphan |
| d-Norpseudoephedrine hydrochloride |
