Introduction:Basic information about CAS 885520-31-0|4-Fluoro-1H-indole-6-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoro-1H-indole-6-carboxylic acid |
|---|
| CAS Number | 885520-31-0 | Molecular Weight | 179.148 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 418.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.9±23.2 °C |
|---|
Names
| Name | 4-Fluoro-1H-indole-6-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 418.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 |
|---|
| Molecular Weight | 179.148 |
|---|
| Flash Point | 206.9±23.2 °C |
|---|
| Exact Mass | 179.038254 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 2.09 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.692 |
|---|
| InChIKey | AZRLJGFDKLHDFM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(F)c2cc[nH]c2c1 |
|---|
Synonyms
| 4-Fluoro-6-indole carboxylic acid |
| 1H-Indole-6-carboxylic acid, 4-fluoro- |
| 4-Fluoro-1H-indole-6-carboxylic acid |