Introduction：Basic information about CAS 22428-30-4|5,5'-METHYLENEBIS(2-AMINOPHENOL), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5'-METHYLENEBIS(2-AMINOPHENOL) |
|---|
| CAS Number | 22428-30-4 | Molecular Weight | 230.26200 |
|---|
| Density | 1.352g/cm3 | Boiling Point | 462.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H14N2O2 | Melting Point | 222-224℃ |
|---|
| MSDS | / | Flash Point | 233.7ºC |
|---|
Names
| Name | 2-amino-5-[(4-amino-3-hydroxyphenyl)methyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.352g/cm3 |
|---|
| Boiling Point | 462.8ºC at 760mmHg |
|---|
| Melting Point | 222-224℃ |
|---|
| Molecular Formula | C13H14N2O2 |
|---|
| Molecular Weight | 230.26200 |
|---|
| Flash Point | 233.7ºC |
|---|
| Exact Mass | 230.10600 |
|---|
| PSA | 92.50000 |
|---|
| LogP | 3.01540 |
|---|
| Vapour Pressure | 3.46E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.727 |
|---|
| InChIKey | RCYNJDVUURMJOZ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Cc2ccc(N)c(O)c2)cc1O |
|---|
Synonyms
| 3,3'-Dioxy-4,4'-diaminodiphenylmethan |
| 6,6'-diamino-3,3'-methanediyl-bis-phenol |
| 3,3'-Dihydroxy-4,4'-diaminodiphenylmethane |
