Introduction：Basic information about CAS 115473-63-7|rupestonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rupestonic acid |
|---|
| CAS Number | 115473-63-7 | Molecular Weight | 248.31700 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 438ºC at 760mmHg |
|---|
| Molecular Formula | C15H20O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.8ºC |
|---|
Names
| Name | rupestonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 438ºC at 760mmHg |
|---|
| Molecular Formula | C15H20O3 |
|---|
| Molecular Weight | 248.31700 |
|---|
| Flash Point | 232.8ºC |
|---|
| Exact Mass | 248.14100 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.96890 |
|---|
| Vapour Pressure | 6.76E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | ZFHSKBJBODQVBX-UWJYBYFXSA-N |
|---|
| SMILES | C=C(C(=O)O)C1CCC(C)C2CC(=O)C(C)=C2C1 |
|---|
| Storage condition | 2-8℃ |
|---|
Synonyms
| (5S,8S,8aS)-2-(3,8-dimethyl-2-oxo-1,2,4,5,6,7,8,8a-octahydroazulen-5-yl)acrylic acid |
| 2-[(5S,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoic acid |
