Introduction：Basic information about CAS 7675-04-9|5,6-DIHYDRO-4H-THIENO[2,3-B]THIOPYRAN-4-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-DIHYDRO-4H-THIENO[2,3-B]THIOPYRAN-4-ONE |
|---|
| CAS Number | 7675-04-9 | Molecular Weight | 170.25200 |
|---|
| Density | 1.398 | Boiling Point | 308.283ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6OS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140.245ºC |
|---|
Names
| Name | 5,6-dihydrothieno[2,3-b]thiopyran-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.398 |
|---|
| Boiling Point | 308.283ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6OS2 |
|---|
| Molecular Weight | 170.25200 |
|---|
| Flash Point | 140.245ºC |
|---|
| Exact Mass | 169.98600 |
|---|
| PSA | 70.61000 |
|---|
| LogP | 2.42660 |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | QHIWYFNTGCSHTG-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCSc2sccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 5,6-dihydro-thieno[2,3-b]thiopyran-4-one |
| InChI=1/C7H6OS2/c8-6-2-4-10-7-5(6)1-3-9-7/h1,3H,2,4H |
| 5,6-Dihydro-4H-thieno[2,3-b]thiopyran-4-one |
| 5,6-dihydro-4H-4-oxothieno[2,3-b]thiopyran |
