Introduction:Basic information about CAS 247237-38-3|5-Chloro-2-[[(4-methylphenyl)sulfonyl]amino]benzoic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-[[(4-methylphenyl)sulfonyl]amino]benzoic acid methyl ester |
|---|
| CAS Number | 247237-38-3 | Molecular Weight | 339.79400 |
|---|
| Density | 1.39 | Boiling Point | 483.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14ClNO4S | Melting Point | 115ºC |
|---|
| MSDS | / | Flash Point | 246.5ºC |
|---|
Names
| Name | methyl 5-chloro-2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39 |
|---|
| Boiling Point | 483.9ºC at 760 mmHg |
|---|
| Melting Point | 115ºC |
|---|
| Molecular Formula | C15H14ClNO4S |
|---|
| Molecular Weight | 339.79400 |
|---|
| Flash Point | 246.5ºC |
|---|
| Exact Mass | 339.03300 |
|---|
| PSA | 80.85000 |
|---|
| LogP | 4.38960 |
|---|
| Vapour Pressure | 1.61E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | ULLAAIMUVLVAJX-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C)cc1 |
|---|
Synonyms
| 4'-chloro-2'-methoxycarbonyl-p-toluenesulfonanilide |
| I06-1506 |
| methyl 5-chloro-2-(N-p-toluenesulfonyl)aminobenzoate |
| N-p-toluenesulfonyl-5-chloro-anthranilic acid methyl ester |
| methyl 5-chloranyl-2-[(4-methylphenyl)sulfonylamino]benzoate |
| 5-Chloro-2-(toluene-4-sulfonylamino)-benzoic acid methyl ester |