Introduction：Basic information about CAS 234096-34-5|Cefovecin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cefovecin |
|---|
| CAS Number | 234096-34-5 | Molecular Weight | 453.49300 |
|---|
| Density | 1.859g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H19N5O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(2S)-oxolan-2-yl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.859g/cm3 |
|---|
| Molecular Formula | C17H19N5O6S2 |
|---|
| Molecular Weight | 453.49300 |
|---|
| Exact Mass | 453.07800 |
|---|
| PSA | 214.20000 |
|---|
| LogP | 0.70170 |
|---|
| Index of Refraction | 1.832 |
|---|
| InChIKey | ZJGQFXVQDVCVOK-QFKLAVHZSA-N |
|---|
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C3CCCO3)CSC12)c1csc(N)n1 |
|---|
