Introduction:Basic information about CAS 112966-96-8|Domitroban, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Domitroban |
|---|
| CAS Number | 112966-96-8 | Molecular Weight | 377.49800 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 563.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H27NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 294.5ºC |
|---|
Names
| Name | (5Z)-7-{(1R,2S,3S,4S)-3-[(Phenylsulfonyl)amino]bicyclo[2.2.1]hept -2-yl}-5-heptenoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 563.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H27NO4S |
|---|
| Molecular Weight | 377.49800 |
|---|
| Flash Point | 294.5ºC |
|---|
| Exact Mass | 377.16600 |
|---|
| PSA | 91.85000 |
|---|
| LogP | 5.05250 |
|---|
| Vapour Pressure | 1.58E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | PWTCIBWRMQFJBC-ZEMKZVSASA-N |
|---|
| SMILES | O=C(O)CCCC=CCC1C2CCC(C2)C1NS(=O)(=O)c1ccccc1 |
|---|
Synonyms
| (+)-(5S,10S)-12-hydroxypodocarpa-8,11,13-triene |
| podocarpatrien-(C)-ol-(12) |
| (1R,2S,3S,4S)-(5Z)-7-(3-((Phenylsulfonyl)amino)bicyclo<2.2.1>hept-2-yl)hept-5-enoic Acid |
| (+)5(Z)-7-[3-endo-phenylsulfonylamino[2.2.1]-bicyclohept-2-exo-yl]-heptenoic acid |
| (+)-(5Z)-7-(3-endo-((Phenylsulfonyl)amino)bicyclo<2.2.1>hept-2-exo-yl)heptenoic Acid |
| (4aS)-6-Hydroxy-1.1.4ar-trimethyl-(10atH)-1.2.3.4.4a.9.10.10a-octahydro-phenanthren |
| trans-6-Hydroxy-1,1,12-trimethyl-1,2,3,4,9,10,11,12-octahydro-phenanthren |
| 12-hydroxypodocarpa-8,11,13-triene |
| 3-Phenanthrenol,4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-,(4bS-trans) |
| (4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
| podocarpa-8,11,13-trien-12-ol |