Introduction:Basic information about CAS 75616-02-3|Dulozafone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dulozafone |
|---|
| CAS Number | 75616-02-3 | Molecular Weight | 425.30600 |
|---|
| Density | 1.365g/cm3 | Boiling Point | 629.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22Cl2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 334.4ºC |
|---|
Names
| Name | 2-[bis(2-hydroxyethyl)amino]-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]-N-methylacetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.365g/cm3 |
|---|
| Boiling Point | 629.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22Cl2N2O4 |
|---|
| Molecular Weight | 425.30600 |
|---|
| Flash Point | 334.4ºC |
|---|
| Exact Mass | 424.09600 |
|---|
| PSA | 81.08000 |
|---|
| LogP | 2.47380 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | BYWMOMBWRFUAMC-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=O)CN(CCO)CCO)c1ccc(Cl)cc1C(=O)c1ccccc1Cl |
|---|
Synonyms
| Dulozafonum |
| Dulozafona [Spanish] |
| dulozafone[inn] |
| 2-(bis(2-hydroxyethyl)amino)-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]-N-methylacetamide |
| Dulozafonum [Latin] |
| Dulozafona |
| Dulozafone |