Introduction：Basic information about CAS 10322-73-3|Estrofurate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Estrofurate |
|---|
| CAS Number | 10322-73-3 | Molecular Weight | 378.46100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 462.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H26O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.6ºC |
|---|
Names
| Name | [(9S,13S,14S,17S)-17-(furan-3-yl)-17-hydroxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 462.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H26O4 |
|---|
| Molecular Weight | 378.46100 |
|---|
| Flash Point | 233.6ºC |
|---|
| Exact Mass | 378.18300 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 4.86890 |
|---|
| Vapour Pressure | 2.36E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | AEVUURWLDCELOV-AYVPJYCDSA-N |
|---|
| SMILES | CC(=O)Oc1ccc2c(c1)CC=C1C2CCC2(C)C1CCC2(O)c1ccoc1 |
|---|
Synonyms
| Estrofuratum [INN-Latin] |
| 21,23-Epoxy-19,24-dinor-17alpha-chola-1,3,5(10),7,20,22-hexaene-3,17-diol 3-acetate |
| Estrofurato [INN-Spanish] |
| estrofurate |
