Introduction：Basic information about CAS 72324-44-8|N-p-Tolyl-Malonamic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-p-Tolyl-Malonamic acid ethyl ester |
|---|
| CAS Number | 72324-44-8 | Molecular Weight | 221.25200 |
|---|
| Density | 1.153g/cm3 | Boiling Point | 390.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190ºC |
|---|
Names
| Name | ethyl 3-(4-methylanilino)-3-oxopropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.153g/cm3 |
|---|
| Boiling Point | 390.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Flash Point | 190ºC |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.95970 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | GXTAUIKNWDHZLE-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)Nc1ccc(C)cc1 |
|---|
Synonyms
| ethyl 3-oxo-3-(4-toluidino)propanoate |
| ethyl p-methylmalonanilate |
| ethyl 3-oxo-3-(4-tolylamino)propanoate |
| p-toluidide of monoethyl malonate |
| N-(p-tolyl)malonamic acid ethyl ester |
| ethyl 2-(p-methylanilido)ethanoate |
| N-p-Tolyl-malonamidsaeure-aethylester |
