Introduction：Basic information about CAS 7696-00-6|Mitotenamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mitotenamine |
|---|
| CAS Number | 7696-00-6 | Molecular Weight | 332.68700 |
|---|
| Density | 1.445g/cm3 | Boiling Point | 368.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15BrClNS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176.7ºC |
|---|
Names
| Name | N-[(5-bromo-1-benzothiophen-3-yl)methyl]-2-chloro-N-ethylethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.445g/cm3 |
|---|
| Boiling Point | 368.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15BrClNS |
|---|
| Molecular Weight | 332.68700 |
|---|
| Flash Point | 176.7ºC |
|---|
| Exact Mass | 330.98000 |
|---|
| PSA | 31.48000 |
|---|
| LogP | 4.72450 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | SZLHBBCRNVPTRZ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCCl)Cc1csc2ccc(Br)cc12 |
|---|
Synonyms
| UNII-2879S26V4P |
| Mitotenaminum |
| Mitotenamine |
| Mitotenamine [INN:BAN] |
| Mitotenamina |
