Introduction：Basic information about CAS 75992-53-9|Moxadolen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Moxadolen |
|---|
| CAS Number | 75992-53-9 | Molecular Weight | 223.22500 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 434.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.7ºC |
|---|
Names
| Name | (1S,2R,3S,6S,7R)-5-Oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl methylcarbamate |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 434.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO4 |
|---|
| Molecular Weight | 223.22500 |
|---|
| Flash Point | 216.7ºC |
|---|
| Exact Mass | 223.08400 |
|---|
| PSA | 68.12000 |
|---|
| LogP | 0.86800 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | ZMXUEEVRCMPQPF-UTABRTIASA-N |
|---|
| SMILES | CNC(=O)OC1OC(=O)C2C3C=CC(C3)C12 |
|---|
