Introduction：Basic information about CAS 17692-56-7|Moxicoumone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Moxicoumone |
|---|
| CAS Number | 17692-56-7 | Molecular Weight | 418.48300 |
|---|
| Density | 1.212g/cm3 | Boiling Point | 603.8ºC at 760mmHg |
|---|
| Molecular Formula | C22H30N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 319ºC |
|---|
Names
| Name | 4-methyl-5,7-bis(2-morpholin-4-ylethoxy)chromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.212g/cm3 |
|---|
| Boiling Point | 603.8ºC at 760mmHg |
|---|
| Molecular Formula | C22H30N2O6 |
|---|
| Molecular Weight | 418.48300 |
|---|
| Flash Point | 319ºC |
|---|
| Exact Mass | 418.21000 |
|---|
| PSA | 73.61000 |
|---|
| LogP | 1.39920 |
|---|
| Vapour Pressure | 1.56E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | KHVVROKBGPRWFA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)oc2cc(OCCN3CCOCC3)cc(OCCN3CCOCC3)c12 |
|---|
Synonyms
| Moxicoumonum [INN-Latin] |
| Moxicumonum |
| 4-methyl-5,7-bis-(2-morpholin-4-yl-ethoxy)-chromen-2-one |
| Moxicumona |
| Mossicoumone |
| Mossicoumone [DCIT] |
| Moxicoumonum |
| Moxicoumone |
| Moxicumona [INN-Spanish] |
| 5,7-Bis-<2-morpholino-aethoxy>-4-methyl-cumarin |
