Introduction：Basic information about CAS 103238-56-8|Parodilol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Parodilol |
|---|
| CAS Number | 103238-56-8 | Molecular Weight | 377.47900 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 645.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H27N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 344.2ºC |
|---|
Names
| Name | 1-[[1-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]-3-(1H-indol-4-yloxy)propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 645.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H27N3O2 |
|---|
| Molecular Weight | 377.47900 |
|---|
| Flash Point | 344.2ºC |
|---|
| Exact Mass | 377.21000 |
|---|
| PSA | 73.07000 |
|---|
| LogP | 4.39070 |
|---|
| Vapour Pressure | 1.51E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | RJZLPXDYXSPJSS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Cc1c[nH]c2ccccc12)NCC(O)COc1cccc2[nH]ccc12 |
|---|
Synonyms
| UNII-0Q1O6G98Q8 |
| Parodilol [INN] |
| Parodilol |
