Introduction：Basic information about CAS 469-80-7|Pheneridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pheneridine |
|---|
| CAS Number | 469-80-7 | Molecular Weight | 337.45500 |
|---|
| Density | 1.079g/cm3 | Boiling Point | 444.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H27NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.9ºC |
|---|
Names
| Name | ethyl 4-phenyl-1-(2-phenylethyl)piperidine-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.079g/cm3 |
|---|
| Boiling Point | 444.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H27NO2 |
|---|
| Molecular Weight | 337.45500 |
|---|
| Flash Point | 135.9ºC |
|---|
| Exact Mass | 337.20400 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 3.76390 |
|---|
| Vapour Pressure | 4.14E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | IUNKCJPURQMGKG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCc2ccccc2)CC1 |
|---|
Synonyms
| Pheneridine [INN] |
| Pheneridine |
| 1-phenethyl-4-phenyl-piperidine-4-carboxylic acid ethyl ester |
| ethyl 1-phenethyl-4-phenylpiperidine-4-carboxylate |
| 1-Phenethyl-4-phenyl-4-ethoxycarbonyl-piperidin |
| 1-(2-Phenylethyl)-4-phenylpiperidine-4-carboxylic acid ethyl ester |
| 1-Phenaethyl-4-phenyl-piperidin-4-carbonsaeure-aethylester |
| UNII-2UG271VI0Z |
| Ethyl-4-phenyl-1-phenethylpiperidin-4-carboxylat |
