Introduction：Basic information about CAS 69479-26-1|Pirepolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pirepolol |
|---|
| CAS Number | 69479-26-1 | Molecular Weight | 420.50300 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 613.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H32N4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 324.8ºC |
|---|
Names
| Name | 6-[(2-{[3-(4-Butoxyphenoxy)-2-hydroxypropyl]amino}ethyl)amino]-1, 3-dimethyl-2,4(1H,3H)-pyrimidinedione |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 613.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H32N4O5 |
|---|
| Molecular Weight | 420.50300 |
|---|
| Flash Point | 324.8ºC |
|---|
| Exact Mass | 420.23700 |
|---|
| PSA | 106.75000 |
|---|
| LogP | 1.16820 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | BAPQHWDWPMIUKD-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(OCC(O)CNCCNc2cc(=O)n(C)c(=O)n2C)cc1 |
|---|
