Introduction：Basic information about CAS 15949-72-1|(2S,5R,6R)-6-({[1-(2,6-Dichlorophenyl)-4-methyl-1H-pyrazol-5-yl]c arbonyl}amino)-3,3-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2S,5R,6R)-6-({[1-(2,6-Dichlorophenyl)-4-methyl-1H-pyrazol-5-yl]c arbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hepta ne-2-carboxylic acid |
|---|
| CAS Number | 15949-72-1 | Molecular Weight | 469.34200 |
|---|
| Density | 1.67g/cm3 | Boiling Point | 743.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H18Cl2N4O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 403.5ºC |
|---|
Names
| Name | (2S,5R,6R)-6-({[1-(2,6-Dichlorophenyl)-4-methyl-1H-pyrazol-5-yl]c arbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hepta ne-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.67g/cm3 |
|---|
| Boiling Point | 743.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H18Cl2N4O4S |
|---|
| Molecular Weight | 469.34200 |
|---|
| Flash Point | 403.5ºC |
|---|
| Exact Mass | 468.04300 |
|---|
| PSA | 129.83000 |
|---|
| LogP | 3.06160 |
|---|
| Vapour Pressure | 3.24E-23mmHg at 25°C |
|---|
| Index of Refraction | 1.751 |
|---|
| InChIKey | XRCKXULNIUSXFZ-HYSWKAIVSA-N |
|---|
| SMILES | Cc1cnn(-c2c(Cl)cccc2Cl)c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
|---|
