Introduction:Basic information about CAS 55837-22-4|Pribecaine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pribecaine |
|---|
| CAS Number | 55837-22-4 | Molecular Weight | 277.35900 |
|---|
| Density | 1.075g/cm3 | Boiling Point | 403.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.6ºC |
|---|
Names
| Name | 3-piperidin-1-ylpropyl 3-methoxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.075g/cm3 |
|---|
| Boiling Point | 403.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 |
|---|
| Molecular Weight | 277.35900 |
|---|
| Flash Point | 197.6ºC |
|---|
| Exact Mass | 277.16800 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 2.66590 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | MDEHCYRQFACAGY-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(C(=O)OCCCN2CCCCC2)c1 |
|---|
Synonyms
| Pribecaine [INN] |
| UNII-382TLA8X28 |
| 3-Piperidinopropyl m-anisate |
| Pribecaine |