Introduction：Basic information about CAS 415973-05-6|(R)-Rivastigmine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-Rivastigmine |
|---|
| CAS Number | 415973-05-6 | Molecular Weight | 250.33700 |
|---|
| Density | 1.038±0.06 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H22N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 316.2±34.0 °C(Predicted) |
|---|
Names
| Name | [3-[(1R)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.038±0.06 g/cm3 |
|---|
| Molecular Formula | C14H22N2O2 |
|---|
| Molecular Weight | 250.33700 |
|---|
| Flash Point | 316.2±34.0 °C(Predicted) |
|---|
| Exact Mass | 250.16800 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 2.75970 |
|---|
| InChIKey | XSVMFMHYUFZWBK-LLVKDONJSA-N |
|---|
| SMILES | CCN(C)C(=O)Oc1cccc(C(C)N(C)C)c1 |
|---|
| Water Solubility | Sparingly soluble (25 g/L) (25 ºC) |
|---|
Safety Information
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Rivastigmine hydrogen tartrate specified impurity D [EP] |
| (R)-3-(1-(Dimethylamino)ethyl)phenyl ethyl(methyl)carbamate |
| Rivastigmine tartrate R-isomer |
| (R)-Rivastigmine |
| Rivastigmine specified impurity D [EP] |
| Rivastigmine,(R) |
| Rivastigmine impurity D |
| UNII-Z25UDQ15MV |
| (R)-Rivastigmine |
| Rivastigmine Impurity 4 |
