Introduction:Basic information about CAS 60077-62-5|Villosol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Villosol |
|---|
| CAS Number | 60077-62-5 | Molecular Weight | 408.40100 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 629.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H20O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 629.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H20O7 |
|---|
| Molecular Weight | 408.40100 |
|---|
| Flash Point | 222.5ºC |
|---|
| Exact Mass | 408.12100 |
|---|
| PSA | 87.36000 |
|---|
| LogP | 3.95480 |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | STFNGWNFASVBRR-CQSZACIVSA-N |
|---|
| SMILES | C=C(C)C1Cc2c(cc(O)c3c(=O)c4c(oc23)COc2cc(OC)c(OC)cc2-4)O1 |
|---|
| Storage condition | 2-8℃ |
|---|