Introduction：Basic information about CAS 17528-28-8|2-[4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethyl heptanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethyl heptanoate |
|---|
| CAS Number | 17528-28-8 | Molecular Weight | 516.13800 |
|---|
| Density | 1.162g/cm3 | Boiling Point | 632ºC at 760 mmHg |
|---|
| Molecular Formula | C28H38ClN3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 336ºC |
|---|
Names
| Name | 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl heptanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.162g/cm3 |
|---|
| Boiling Point | 632ºC at 760 mmHg |
|---|
| Molecular Formula | C28H38ClN3O2S |
|---|
| Molecular Weight | 516.13800 |
|---|
| Flash Point | 336ºC |
|---|
| Exact Mass | 515.23700 |
|---|
| PSA | 61.32000 |
|---|
| LogP | 6.40480 |
|---|
| Vapour Pressure | 7.05E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | PWEGQJCIAMJJHC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
|---|
Synonyms
| Perphenazine enantate |
| Perphenazine enanthate |
| EINECS 241-529-9 |
| UNII-Z6RS3DKN8J |
