Introduction：Basic information about CAS 17560-54-2|2-(acetylamino)-5-(aminosulphonyl)-4-chlorobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(acetylamino)-5-(aminosulphonyl)-4-chlorobenzoic acid |
|---|
| CAS Number | 17560-54-2 | Molecular Weight | 292.69600 |
|---|
| Density | 1.663g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H9ClN2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-acetamido-4-chloro-5-sulfamoylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.663g/cm3 |
|---|
| Molecular Formula | C9H9ClN2O5S |
|---|
| Molecular Weight | 292.69600 |
|---|
| Exact Mass | 291.99200 |
|---|
| PSA | 138.43000 |
|---|
| LogP | 3.07460 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | YUHXSVUWDBFINU-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cc(Cl)c(S(N)(=O)=O)cc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-chloro-5sulfamyl-N-acetylanthranilic acid |
| 2-acetylamino-4-chloro-5-sulfamoyl-benzoic acid |
| 2-Acetamido-4-chlor-5-sulfamoylbenzoesaeure |
| 2-Acetylamino-4-chlor-5-sulfamoyl-benzoesaeure |
| N-Acetyl-4-chlor-5-sulfamoylanthranilsaeure |
| 4-Chlor-5-sulfamoyl-N-acetylanthranilsaeure |
| EINECS 241-540-9 |
