Introduction：Basic information about CAS 62785-90-4|1-Ethynyl-1-(trimethylsiloxy)cyclohexane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Ethynyl-1-(trimethylsiloxy)cyclohexane |
|---|
| CAS Number | 62785-90-4 | Molecular Weight | 196.36100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H20OSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (1-ethynylcyclohexyl)oxy-trimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H20OSi |
|---|
| Molecular Weight | 196.36100 |
|---|
| Exact Mass | 196.12800 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 3.17400 |
|---|
| InChIKey | KJDMMCYMVUTZSN-UHFFFAOYSA-N |
|---|
| SMILES | C#CC1(O[Si](C)(C)C)CCCCC1 |
|---|
Safety Information
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-(1-trimethylsilyloxycyclohexyl)-1-ethyne |
| 1-ethenyl-1-(trimethylsilyloxy)cyclohexane |
| Silane,[(1-ethynylcyclohexyl)oxy]trimethyl |
| [(1-Ethynylcyclohexyl)oxy](trimethyl)silane |
| 2(1-trimethylsilyloxycyclohexyl)-eth-1-yne |
| 2-(1-trimethylsiloxycyclohexyl)ethyne |
| 1-ethynyl-1-trimethylsilyloxycyclohexane |
| 1-ethynyl-1-trimethylsiloxy-cyclohexane |
