Introduction：Basic information about CAS 7292-14-0|2,2'-(3,5,5-trimethylhexylidene)bis[4,6-dimethylphenol], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-(3,5,5-trimethylhexylidene)bis[4,6-dimethylphenol] |
|---|
| CAS Number | 7292-14-0 | Molecular Weight | 368.55200 |
|---|
| Density | 1.012g/cm3 | Boiling Point | 482.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H36O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.2ºC |
|---|
Names
| Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,5,5-trimethylhexyl]-4,6-dimethylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.012g/cm3 |
|---|
| Boiling Point | 482.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H36O2 |
|---|
| Molecular Weight | 368.55200 |
|---|
| Flash Point | 204.2ºC |
|---|
| Exact Mass | 368.27200 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 6.92570 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | RPWDFMGIRPZGTI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(O)c(C(CC(C)CC(C)(C)C)c2cc(C)cc(C)c2O)c1 |
|---|
Synonyms
| EINECS 230-721-8 |
| 2,2'-(3,5,5-Trimethylhexylidene)bis(4,6-dimethylphenol) |
| 1,1-bis(2-hydroxy-3,5-dimethylphenyl)-3,5,5-trimethylhexane |
| Permanax WSO |
