Introduction：Basic information about CAS 72928-30-4|4'-cyano[1,1'-biphenyl]-4-yl 4'-heptyl[1,1'-biphenyl]-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-cyano[1,1'-biphenyl]-4-yl 4'-heptyl[1,1'-biphenyl]-4-carboxylate |
|---|
| CAS Number | 72928-30-4 | Molecular Weight | 473.60500 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 643.4ºC at 760 mmHg |
|---|
| Molecular Formula | C33H31NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 332.8ºC |
|---|
Names
| Name | [4-(4-cyanophenyl)phenyl] 4-(4-heptylphenyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 643.4ºC at 760 mmHg |
|---|
| Molecular Formula | C33H31NO2 |
|---|
| Molecular Weight | 473.60500 |
|---|
| Flash Point | 332.8ºC |
|---|
| Exact Mass | 473.23500 |
|---|
| PSA | 50.09000 |
|---|
| LogP | 8.62438 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | YTSKNVPWUIOPIL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
|---|
Synonyms
| 4'-Cyano(1,1'-biphenyl)-4-yl 4'-heptyl(1,1'-biphenyl)-4-carboxylate |
| EINECS 277-064-3 |
| 4'-Cyanobiphenyl-4-yl4'-heptylbiphenyl-4-carboxylate |
