Introduction：Basic information about CAS 85-64-3|laudanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | laudanine |
|---|
| CAS Number | 85-64-3 | Molecular Weight | 343.41700 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 485.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.6ºC |
|---|
Names
| Name | laudanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 485.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25NO4 |
|---|
| Molecular Weight | 343.41700 |
|---|
| Flash Point | 247.6ºC |
|---|
| Exact Mass | 343.17800 |
|---|
| PSA | 51.16000 |
|---|
| LogP | 3.12760 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | MPYHGNAJOKCMAQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CCN2C)cc1O |
|---|
Synonyms
| (+/-)-laudanidine |
| 5-[(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2-methoxyphenol |
| DL-laudanosoline |
| dl-laudanidine |
| 5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydro-[1]isoquinolylmethyl)-2-methoxy-phenol |
| 5-(6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-[1]isochinolylmethyl)-2-methoxy-phenol |
| (RS)-laudanosoline |
| (+-)-laudanosoline |
| 5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinolin-1-ylmethyl)-2-methoxy-phenol |
| racemic laudanosoline |
| Laudanine |
