Introduction：Basic information about CAS 85-67-6|8-amino-5-[(p-aminophenyl)azo]naphthalene-2-sulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-amino-5-[(p-aminophenyl)azo]naphthalene-2-sulphonic acid |
|---|
| CAS Number | 85-67-6 | Molecular Weight | 342.37200 |
|---|
| Density | 1.52g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H14N4O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 8-amino-5-[(4-aminophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Molecular Formula | C16H14N4O3S |
|---|
| Molecular Weight | 342.37200 |
|---|
| Exact Mass | 342.07900 |
|---|
| PSA | 139.51000 |
|---|
| LogP | 5.90950 |
|---|
| Index of Refraction | 1.722 |
|---|
| InChIKey | PUFPLSIDSWPRQM-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(N=Nc2ccc(N)c3cc(S(=O)(=O)O)ccc23)cc1 |
|---|
Safety Information
| Safety Phrases | S16-S26-S36/37/39 |
|---|
Synonyms
| 8-Amino-5-((p-aminophenyl)azo)-2-naphthalenesulfonic acid |
| 2-Naphthalenesulfonic acid,8-amino-5-((4-aminophenyl)azo) |
| 2-Naphthalenesulfonic acid,8-amino-5-(2-(4-aminophenyl)diazenyl) |
| EINECS 201-621-1 |
| 8-Amino-5-((p-aminophenyl)azo)naphthalene-2-sulphonic acid |
