Introduction：Basic information about CAS 75128-73-3|9-[(2-Acetoxyethoxy)methyl]-acetylguanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-[(2-Acetoxyethoxy)methyl]-acetylguanine |
|---|
| CAS Number | 75128-73-3 | Molecular Weight | 309.278 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H15N5O5 | Melting Point | 204°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9-[(2-Acetoxyethoxy)Methyl]-N2-Acetylguanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 204°C |
|---|
| Molecular Formula | C12H15N5O5 |
|---|
| Molecular Weight | 309.278 |
|---|
| Exact Mass | 309.107330 |
|---|
| PSA | 128.20000 |
|---|
| LogP | -0.75 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | VBHLKZHSCMQLTI-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1nc2c(ncn2COCCOC(C)=O)c(=O)[nH]1 |
|---|
Safety Information
| Hazard Codes | Xn,Xi |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2-[(2-Acetamido-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl acetate |
| 9-[(2-Acetoxyethoxy)methyl]-N2-acetylguanine |
| 9-[(2-Acetoxyethoxy)methyl]-acetylguanine |
| MFCD00267706 |
| EINECS 278-077-7 |
| 2-{[2-(acetylamino)-6-oxo-1,6-dihydro-9H-purin-9-yl]methoxy}ethyl acetate |
| Acetamide, N-[9-[[2-(acetyloxy)ethoxy]methyl]-6,9-dihydro-6-oxo-1H-purin-2-yl]- |
