Introduction:Basic information about CAS 94242-54-3|4-(4-OXOQUINAZOLIN-3(4H)-YL)BENZOIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-OXOQUINAZOLIN-3(4H)-YL)BENZOIC ACID |
|---|
| CAS Number | 94242-54-3 | Molecular Weight | 266.25200 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 519.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.1ºC |
|---|
Names
| Name | 4-(4-oxoquinazolin-3-yl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 519.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H10N2O3 |
|---|
| Molecular Weight | 266.25200 |
|---|
| Flash Point | 268.1ºC |
|---|
| Exact Mass | 266.06900 |
|---|
| PSA | 72.19000 |
|---|
| LogP | 2.08390 |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | GTGLPZFNBPATOL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-n2cnc3ccccc3c2=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(Chinazolin-4-on-3-yl)-benzoesaeure |
| 3-(4-carboxylphenyl)-4(3H)-quinazolinone |
| 4-(4-oxo-4H-quinazolin-3-yl)-benzoic acid |
| 4-(4-Oxo-4H-chinazolin-3-yl)-benzoesaeure |
| 3-(4-carboxyphenyl)quinazolin-4(3H)-one |
| 4-(4-oxoquinazolin-3(4H)-yl)benzoic acid |
| F1217-0014 |
| 3-(4-carboxylphenyl)quinazolin-4(3H)-one |