Introduction:Basic information about CAS 94250-54-1|2-Methyl-2-propanyl 4-methyl-3-oxopentanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-2-propanyl 4-methyl-3-oxopentanoate |
|---|
| CAS Number | 94250-54-1 | Molecular Weight | 186.248 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 208.0±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 78.2±18.5 °C |
|---|
Names
| Name | tert-butyl 4-methyl-3-oxopentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 208.0±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H18O3 |
|---|
| Molecular Weight | 186.248 |
|---|
| Flash Point | 78.2±18.5 °C |
|---|
| Exact Mass | 186.125595 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.29 |
|---|
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.428 |
|---|
| InChIKey | BTHNEHUFXUBOQG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(=O)CC(=O)OC(C)(C)C |
|---|
Synonyms
| Pentanoic acid,4-methyl-3-oxo-,1,1-dimethylethyl ester |
| t-butyl isobutyrylacetate |
| Pentanoic acid, 4-methyl-3-oxo-, 1,1-dimethylethyl ester |
| tert-butyl 4-methyl-3-oxo-pentanoate |
| 2-Methyl-2-propanyl 4-methyl-3-oxopentanoate |
| tert-butyl isobutyrylacetate |