Introduction：Basic information about CAS 374822-27-2|1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine Hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine Hydrochloride |
|---|
| CAS Number | 374822-27-2 | Molecular Weight | 293.637 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H10ClF6N | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanamine,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H10ClF6N |
|---|
| Molecular Weight | 293.637 |
|---|
| Exact Mass | 293.040588 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 5.24620 |
|---|
| InChIKey | DWSPCWWXKNPRFN-UHFFFAOYSA-N |
|---|
| SMILES | CC(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Benzenemethanamine, α-methyl-3,5-bis(trifluoromethyl)-, hydrochloride (1:1) |
| 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine HCl |
| 1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine hydrochloride |
| 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine hydrochloride (1:1) |
| bis-(trifluoromethyl)phenylethylamine hydrochloride |
| (1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethylamine hydrochloride |
