Introduction：Basic information about CAS 67233-85-6|Sodium 5-nitroguaiacolate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium 5-nitroguaiacolate |
|---|
| CAS Number | 67233-85-6 | Molecular Weight | 191.117 |
|---|
| Density | / | Boiling Point | 291ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6NNaO4 | Melting Point | 105-106°C |
|---|
| MSDS | USA | Flash Point | 147.1ºC |
|---|
Names
| Name | 5-Nitroguaiacol Sodium Salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 291ºC at 760 mmHg |
|---|
| Melting Point | 105-106°C |
|---|
| Molecular Formula | C7H6NNaO4 |
|---|
| Molecular Weight | 191.117 |
|---|
| Flash Point | 147.1ºC |
|---|
| Exact Mass | 191.019455 |
|---|
| PSA | 78.11000 |
|---|
| LogP | 2.27040 |
|---|
| InChIKey | KBRKFTKQRMYINW-UHFFFAOYSA-M |
|---|
| SMILES | COc1ccc([N+](=O)[O-])cc1[O-].[Na+] |
|---|
| Water Solubility | soluble |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 1 |
|---|
| HS Code | 2942000000 |
|---|
Customs
| HS Code | 2909500000 |
|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5-Nitroguaiacol sodium salt |
| Sodium 2-methoxy-5-nitrophenoxide |
| Sodium 2-methoxy-5-nitrophenolate |
| Phenol, 2-methoxy-5-nitro-, sodium salt (1:1) |
| MFCD00070570 |
| Sodium 5-nitroguaiacolate |
| WNR CQ DO1 &&Na salt |
| 2-Methoxy-5-nitrophenol sodium salt |
| Phenol, 2-methoxy-5-nitro-, sodium salt |
