Introduction：Basic information about CAS 52821-24-6|2-(3-hydroxypropyl)-6-[(3-hydroxypropyl)amino]-1H-benz[de]isoquinoline-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-hydroxypropyl)-6-[(3-hydroxypropyl)amino]-1H-benz[de]isoquinoline-1,3(2H)-dione |
|---|
| CAS Number | 52821-24-6 | Molecular Weight | 328.36200 |
|---|
| Density | 1.378g/cm3 | Boiling Point | 617.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 327.2ºC |
|---|
Names
| Name | 2-(3-hydroxypropyl)-6-(3-hydroxypropylamino)benzo[de]isoquinoline-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.378g/cm3 |
|---|
| Boiling Point | 617.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20N2O4 |
|---|
| Molecular Weight | 328.36200 |
|---|
| Flash Point | 327.2ºC |
|---|
| Exact Mass | 328.14200 |
|---|
| PSA | 91.56000 |
|---|
| LogP | 1.20240 |
|---|
| Index of Refraction | 1.693 |
|---|
| InChIKey | WPQGAQRPOWJJGT-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2cccc3c(NCCCO)ccc(c23)C(=O)N1CCCO |
|---|
Synonyms
| 4-(3-Hydroxypropylamino)-naphthal(3-hydroxypropyl)imide |
| 2-(3-Hydroxypropyl)-6-((3-hydroxypropyl)amino)-1H-benz(de)isoquinoline-1,3(2H)-dione |
| 1H-Benz(de)isoquinoline-1,3(2H)-dione,2-(3-hydroxypropyl)-6-((3-hydroxypropyl)amino) |
| EINECS 258-203-7 |
