Introduction：Basic information about CAS 935838-06-5|chloropalladium(1+),(1Z,5Z)-cycloocta-1,5-diene,2-methanidyl-2-methylpropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chloropalladium(1+),(1Z,5Z)-cycloocta-1,5-diene,2-methanidyl-2-methylpropane |
|---|
| CAS Number | 935838-06-5 | Molecular Weight | 321.19500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H23ClPd | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | chloropalladium(1+),(1Z,5Z)-cycloocta-1,5-diene,2-methanidyl-2-methylpropane |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H23ClPd |
|---|
| Molecular Weight | 321.19500 |
|---|
| Exact Mass | 320.05200 |
|---|
| LogP | 1.54340 |
|---|
| InChIKey | XLFVUOJKOOAGBQ-PHFPKPIQSA-M |
|---|
| SMILES | C1=CCCC=CCC1.Cl[Pd+].[CH2-]C(C)(C)C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
