Introduction：Basic information about CAS 2896-97-1|2-cyclopropyl formamidoimidazole-5-chloro benzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-cyclopropyl formamidoimidazole-5-chloro benzophenone |
|---|
| CAS Number | 2896-97-1 | Molecular Weight | 299.75200 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 544.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.2ºC |
|---|
Names
| Name | 2-cyclopropyl formamidoimidazole-5-chloro benzophenone |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 544.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14ClNO2 |
|---|
| Molecular Weight | 299.75200 |
|---|
| Flash Point | 283.2ºC |
|---|
| Exact Mass | 299.07100 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 3.99250 |
|---|
| Vapour Pressure | 6.34E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | ASZNGVSVGBZFFG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=O)C1CC1 |
|---|
