Introduction：Basic information about CAS 484-94-6|2-Fluoro-6-nitro anisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-6-nitro anisole |
|---|
| CAS Number | 484-94-6 | Molecular Weight | 171.126 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 266.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6FNO3 | Melting Point | 9 °C |
|---|
| MSDS | / | Flash Point | 114.9±21.8 °C |
|---|
Names
| Name | 1-fluoro-2-methoxy-3-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 266.4±20.0 °C at 760 mmHg |
|---|
| Melting Point | 9 °C |
|---|
| Molecular Formula | C7H6FNO3 |
|---|
| Molecular Weight | 171.126 |
|---|
| Flash Point | 114.9±21.8 °C |
|---|
| Exact Mass | 171.033173 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 1.63 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | RVPBBFKWSJLAPD-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(F)cccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| BENZENE,1-FLUORO-2-METHOXY-3-NITRO |
| 1-Fluoro-2-methoxy-3-nitrobenzene |
| 2-Fluoro-6-nitro anisole |
| 3-fluoro-2-methoxy-1-nitrobenzene |
| 3-Fluoro-2-methoxynitrobenzene |
| 2-Fluoro-6-nitrophenyl methyl ether |
| 2-Fluor-6-nitro-anisol |
| Benzene, 1-fluoro-2-methoxy-3-nitro- |
| 2-nitro-6-fluoroanisole |
| 2-fluoro-6-nitro-anisole |
| fluoro-2 nitro-6 anisole |
