Introduction:Basic information about CAS 89900-99-2|2'-Methyl-[1,1'-Biphenyl]-4-Carboxylic Acid Methyl Ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-Methyl-[1,1'-Biphenyl]-4-Carboxylic Acid Methyl Ester |
|---|
| CAS Number | 89900-99-2 | Molecular Weight | 226.27000 |
|---|
| Density | 1.083g/cm3 | Boiling Point | 335.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.4ºC |
|---|
Names
| Name | methyl 4-(2-methylphenyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.083g/cm3 |
|---|
| Boiling Point | 335.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 148.4ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.44860 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | WBJSBOHFQLCHGX-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2ccccc2C)cc1 |
|---|
Synonyms
| 4-methyloxycarbonyl-2'-methyl-1,1'-biphenyl |
| 4-methoxycarbonyl-2'-methyl-1,1'-biphenyl |
| methyl 2'-methylbiphenyl-4-carboxylate |
| 2'-methylbiphenyl-4-carboxylic acid methyl ester |
| 4-carbomethoxy-2'-methylbiphenyl |