Introduction：Basic information about CAS 17776-69-1|Dichloro(methyl)(4-phenylbutyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dichloro(methyl)(4-phenylbutyl)silane |
|---|
| CAS Number | 17776-69-1 | Molecular Weight | 247.236 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 294.6±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H16Cl2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 125.8±17.1 °C |
|---|
Names
| Name | 4-phenylbutylmethyldichlorosilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 294.6±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H16Cl2Si |
|---|
| Molecular Weight | 247.236 |
|---|
| Flash Point | 125.8±17.1 °C |
|---|
| Exact Mass | 246.039825 |
|---|
| LogP | 6.26 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.503 |
|---|
| InChIKey | MEBCFWIOGCOGTB-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](Cl)(Cl)CCCCc1ccccc1 |
|---|
Synonyms
| Dichloro(methyl)(4-phenylbutyl)silane |
| dichloro-methyl-(4-phenyl-butyl)-silane |
| Dichlor-(4-phenylbutyl)-methylsilan |
| Silane,dichloromethyl[(4-methylphenyl)methyl] |
| <4-Phenyl-butyl>-methyldichlorsilan |
| Dichlor-methyl-(4-phenyl-butyl)-silan |
| Benzene, [4-(dichloromethylsilyl)butyl]- |
| Dichlor-methyl-(4-methyl-benzyl)-silan |
| dichloro-methyl-(4-methyl-benzyl)-silane |
