Introduction：Basic information about CAS 203785-58-4|1,3-Bis-[(chloromethyl)dimethylsiloxy]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Bis-[(chloromethyl)dimethylsiloxy]benzene |
|---|
| CAS Number | 203785-58-4 | Molecular Weight | 323.363 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 294.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H20Cl2O2Si2 | Melting Point | <20ºC |
|---|
| MSDS | / | Flash Point | 110.3±18.1 °C |
|---|
Names
| Name | chloromethyl-[3-[chloromethyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 294.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | <20ºC |
|---|
| Molecular Formula | C12H20Cl2O2Si2 |
|---|
| Molecular Weight | 323.363 |
|---|
| Flash Point | 110.3±18.1 °C |
|---|
| Exact Mass | 322.037872 |
|---|
| PSA | 18.46000 |
|---|
| LogP | -2.99 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | WDQWZASYSJFRSG-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(CCl)Oc1cccc(O[Si](C)(C)CCl)c1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| 1,3-BIS(CHLOROMETHYLDIMETHYLSILYLOXY)BENZENE |
| [1,3-phenylenebis(oxy)]bis[(chloromethyl)dimethylsilane] |
| [1,3-Phenylenebis(oxy)]bis[(chloromethyl)(dimethyl)silane] |
| 1,3-Bis-[(chloromethyl)dimethylsiloxy]benzene |
| Benzene, 1,3-bis[[(chloromethyl)dimethylsilyl]oxy]- |
| 1,3-Bis(chloromethyldimethylsiloxy)benzene |
| G1-SI-1&1&OR CO-SI-1&1&1G |
