Introduction：Basic information about CAS 1438-79-5|pentamethylvinyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pentamethylvinyldisiloxane |
|---|
| CAS Number | 1438-79-5 | Molecular Weight | 174.388 |
|---|
| Density | 0.8±0.1 g/cm3 | Boiling Point | 105.4±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H18OSi2 | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 11.4±19.1 °C |
|---|
Names
| Name | ethenyl-dimethyl-trimethylsilyloxysilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.8±0.1 g/cm3 |
|---|
| Boiling Point | 105.4±9.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C7H18OSi2 |
|---|
| Molecular Weight | 174.388 |
|---|
| Flash Point | 11.4±19.1 °C |
|---|
| Exact Mass | 174.089615 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 3.55 |
|---|
| Vapour Pressure | 34.4±0.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.407 |
|---|
| InChIKey | MRRXLWNSVYPSRB-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C |
|---|
| Storage condition | 2~8℃，Seal |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 11-36/37/38 |
|---|
| Safety Phrases | 3/7-9-16-36/37/39 |
|---|
| RIDADR | UN 1993 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,1,1,3,3-Pentamethyl-3-vinyldisiloxane |
| vinyldimethyisiloxytrimethylsilane |
| Disiloxane, pentamethylvinyl- |
| Pentamethyl-vinyl-disiloxan |
| VINYLPENTAMETHYLDISILOXANE |
| dimethyl(trimethylsiloxy)vinylsilane |
| 1-vinyl-1,1,3,3,3-pentamethyldisiloxane |
| 1,1,3,3,3-pentamethyl-1-vinyldisiloxane |
| Disiloxane, 1-ethenyl-1,1,3,3,3-pentamethyl- |
| Disiloxane,ethenylpentamethyl |
| pentamethylvinyldisiloxane |
| pentamethyl-vinyl-disiloxane |
| Vinyl Pentamethyl Disiloxane |
