Introduction：Basic information about CAS 17887-41-1|tert-butylphenyldichlorosilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butylphenyldichlorosilane |
|---|
| CAS Number | 17887-41-1 | Molecular Weight | 233.210 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 252.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14Cl2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 101.9±14.3 °C |
|---|
Names
| Name | tert-butyl-dichloro-phenylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 252.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14Cl2Si |
|---|
| Molecular Weight | 233.210 |
|---|
| Flash Point | 101.9±14.3 °C |
|---|
| Exact Mass | 232.024185 |
|---|
| LogP | 6.16 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | OCXPCSGIIJESOA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](Cl)(Cl)c1ccccc1 |
|---|
Safety Information
| Risk Phrases | 34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 2987 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| tert-butylphenyldichlorosilane |
| Silane, tert-butyldichlorophenyl- |
| phenyl-tert-butyldichlorosilane |
| tert-Butylphenylchlorosilane |
| tert-Butyl(dichloro)phenylsilane |
| Silane,tert-butyldichlorophenyl |
| tert-Butyl-dichlor-phenyl-silan |
| Silane, dichloro(1,1-dimethylethyl)phenyl- |
| t-butyldichlorophenylsilane |
| t-bu(ph)SiCl3 |
| tert-butyl-dichloro-phenyl-silane |
| Dichloro(2-methyl-2-propanyl)phenylsilane |
| EINECS 241-835-2 |
| Benzene, [dichloro(1,1-dimethylethyl)silyl]- |
