Introduction：Basic information about CAS 17938-06-6|1-Naphthyl Triethoxysilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthyl Triethoxysilane |
|---|
| CAS Number | 17938-06-6 | Molecular Weight | 290.43000 |
|---|
| Density | 1.0476 | Boiling Point | 121-3ºC/0.1mmHg |
|---|
| Molecular Formula | C16H22O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.7ºC |
|---|
Names
| Name | triethoxy(naphthalen-1-yl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0476 |
|---|
| Boiling Point | 121-3ºC/0.1mmHg |
|---|
| Molecular Formula | C16H22O3Si |
|---|
| Molecular Weight | 290.43000 |
|---|
| Flash Point | 159.7ºC |
|---|
| Exact Mass | 290.13400 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.09520 |
|---|
| Vapour Pressure | 0.000208mmHg at 25°C |
|---|
| Index of Refraction | 1.5273 |
|---|
| InChIKey | ZJEYUFMTCHLQQI-UHFFFAOYSA-N |
|---|
| SMILES | CCO[Si](OCC)(OCC)c1cccc2ccccc12 |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
Synonyms
| triethoxy-[1]naphthyl-silane |
| (naphthalen-1-yl)triethoxysilane |
| 1-naphthyltriethoxylsilane |
| Silane,triethoxy-1-naphthalenyl |
| 1-naphthyltriethoxysilane |
| 1-(triethoxysilyl)naphthalene |
| (1-na)Si(Oet)3 |
| 1-Naphthyl Triethoxysilane |
