Introduction：Basic information about CAS 52314-67-7|3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride |
|---|
| CAS Number | 52314-67-7 | Molecular Weight | 227.516 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 242.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H9Cl3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 98.9±25.1 °C |
|---|
Names
| Name | 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 242.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H9Cl3O |
|---|
| Molecular Weight | 227.516 |
|---|
| Flash Point | 98.9±25.1 °C |
|---|
| Exact Mass | 225.971893 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.27 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | CHLAOFANYRDCPD-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)Cl |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| Cyclopropanecarbonyl chloride,3-(2,2-dichloroethenyl)-2,2-dimethyl |
| EINECS 257-840-8 |
| 2,2-dimethyl-3-(2,2-dichlorovinyl)-cyclopropanecarbonyl chloride |
| Cyclopropanecarbonyl chloride, 3-(2,2-dichloroethenyl)-2,2-dimethyl- |
| 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride |
| 3-(2',2'-dichlorovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid chloride |
| 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid chloride |
| 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl chloride |
| 2-(2',2'-dichlorovinyl)-3,3-dimethylcyclopropanecarbonyl chloride |
| permethric acid chloride |
| 3-(2,2-Dichloroethenyl)-2,2-dmethylcyclopropanecarbonyl chloride |
