Introduction：Basic information about CAS 73755-70-1|2-[N-(2-acetyloxyethyl)-2-chloro-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl ace, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[N-(2-acetyloxyethyl)-2-chloro-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl acetate |
|---|
| CAS Number | 73755-70-1 | Molecular Weight | 473.86600 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 707.2ºC at 760 mmHg |
|---|
| Molecular Formula | C21H20ClN5O6 | Melting Point | 127ºC |
|---|
| MSDS | / | Flash Point | 381.5ºC |
|---|
Names
| Name | 2-[N-(2-acetyloxyethyl)-2-chloro-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 707.2ºC at 760 mmHg |
|---|
| Melting Point | 127ºC |
|---|
| Molecular Formula | C21H20ClN5O6 |
|---|
| Molecular Weight | 473.86600 |
|---|
| Flash Point | 381.5ºC |
|---|
| Exact Mass | 473.11000 |
|---|
| PSA | 150.17000 |
|---|
| LogP | 4.99108 |
|---|
| Vapour Pressure | 7.59E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | ZREHDGMXRYSCBE-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCCN(CCOC(C)=O)c1ccc(N=Nc2cccc([N+](=O)[O-])c2C#N)cc1Cl |
|---|
Synonyms
| ({2-chloro-4-[(E)-(2-cyano-3-nitrophenyl)diazenyl]phenyl}imino)diethane-2,1-diyl diacetate |
| EINECS 277-584-0 |
| 2-((4-((2-Cyano-3-nitrophenyl)azo)-2-chlorophenyl)(2-acetoxyethyl)amino)ethyl acetate |
