Introduction：Basic information about CAS 52549-57-2|N-[5-[bis(2-methoxyethyl)amino]-2-[(2-cyano-4-nitrophenyl)azo]phenyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(2-cyano-4-nitrophenyl)azo]phenyl]acetamide |
|---|
| CAS Number | 52549-57-2 | Molecular Weight | 440.45200 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 690ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 371.1ºC |
|---|
Names
| Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(2-cyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 690ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N6O5 |
|---|
| Molecular Weight | 440.45200 |
|---|
| Flash Point | 371.1ºC |
|---|
| Exact Mass | 440.18100 |
|---|
| PSA | 145.13000 |
|---|
| LogP | 4.53568 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | DMMDCPMHDXAIRV-UHFFFAOYSA-N |
|---|
| SMILES | COCCN(CCOC)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
|---|
Synonyms
| N-(5-(Bis(2-methoxyethyl)amino)-2-((2-cyano-4-nitrophenyl)azo)phenyl)acetamide |
| EINECS 257-999-3 |
| Disperse Violet 77 |
| Acetamide,N-(5-(bis(2-methoxyethyl)amino)-2-((2-cyano-4-nitrophenyl)azo)phenyl) |
| Acetamide,N-(5-(bis(2-methoxyethyl)amino)-2-(2-(2-cyano-4-nitrophenyl)diazenyl)phenyl) |
| n-{5-[bis(2-methoxyethyl)amino]-2-[(e)-(2-cyano-4-nitrophenyl)diazenyl]phenyl}acetamide |
