Introduction：Basic information about CAS 56966-52-0|5-chloro-2-(2,4-dichlorophenoxy)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-chloro-2-(2,4-dichlorophenoxy)aniline |
|---|
| CAS Number | 56966-52-0 | Molecular Weight | 288.55700 |
|---|
| Density | 1.456g/cm3 | Boiling Point | 364.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.3ºC |
|---|
Names
| Name | 5-chloro-2-(2,4-dichlorophenoxy)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.456g/cm3 |
|---|
| Boiling Point | 364.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl3NO |
|---|
| Molecular Weight | 288.55700 |
|---|
| Flash Point | 174.3ºC |
|---|
| Exact Mass | 286.96700 |
|---|
| PSA | 35.25000 |
|---|
| LogP | 5.60250 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | SOOLDKUMSVNBIW-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
|---|
Synonyms
| 5-Chloro-2-(2',4'-dichlorophenoxy)aniline |
| 2,4,4'-trichloro-2'-aminodiphenyl ether |
| 5-Chlor-2-(2,4-dichlor-phenoxy)-anilin |
| 5-chloro-2-(2,4-dichlorophenoxy)-benzenamine |
