Introduction：Basic information about CAS 690632-88-3|4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride |
|---|
| CAS Number | 690632-88-3 | Molecular Weight | 273.75900 |
|---|
| Density | 1.438g/cm3 | Boiling Point | 426.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8ClNO2S2 | Melting Point | 76ºC |
|---|
| MSDS | USA | Flash Point | 211.8ºC |
|---|
Names
| Name | 4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.438g/cm3 |
|---|
| Boiling Point | 426.7ºC at 760 mmHg |
|---|
| Melting Point | 76ºC |
|---|
| Molecular Formula | C10H8ClNO2S2 |
|---|
| Molecular Weight | 273.75900 |
|---|
| Flash Point | 211.8ºC |
|---|
| Exact Mass | 272.96800 |
|---|
| PSA | 83.65000 |
|---|
| LogP | 4.12680 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | NGDQQLAVJWUYSF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccccc2)sc1S(=O)(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
