Introduction：Basic information about CAS 41196-04-7|2-Benzimidazolecarbamic acid, 5,6-dichloro-, methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Benzimidazolecarbamic acid, 5,6-dichloro-, methyl ester |
|---|
| CAS Number | 41196-04-7 | Molecular Weight | 260.07700 |
|---|
| Density | 1.641g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H7Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl 5,6-dichloro-1h-benzo[d]imidazol-2-ylcarbamate |
|---|
Chemical & Physical Properties
| Density | 1.641g/cm3 |
|---|
| Molecular Formula | C9H7Cl2N3O2 |
|---|
| Molecular Weight | 260.07700 |
|---|
| Exact Mass | 258.99200 |
|---|
| PSA | 67.01000 |
|---|
| LogP | 3.12100 |
|---|
| Index of Refraction | 1.717 |
|---|
| InChIKey | CQKXCYIZADLCEG-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)Nc1nc2cc(Cl)c(Cl)cc2[nH]1 |
|---|
